C16H33N5 — CID 111056027
1-cyclohexyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine (PubChem CID 111056027) has the molecular formula C16H33N5 and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111056027 |
| Molecular Formula | C16H33N5 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.27 |
| IUPAC Name | 1-cyclohexyl-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN1CCN(C(C)C/N=C(\N)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C16H33N5/c1-3-20-9-11-21(12-10-20)14(2)13-18-16(17)19-15-7-5-4-6-8-15/h14-15H,3-13H2,1-2H3,(H3,17,18,19) |
| InChIKey | BKDSMCGOWIBZEB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|