C19H32IN5O — CID 111598659
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111598659) has the molecular formula C19H32IN5O and a molecular weight of 473.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598659 |
| Molecular Formula | C19H32IN5O |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN1CCN(C(C)C/N=C(\N)NC2CCOc3ccccc32)CC1.I |
| InChI | InChI=1S/C19H31N5O.HI/c1-3-23-9-11-24(12-10-23)15(2)14-21-19(20)22-17-8-13-25-18-7-5-4-6-16(17)18;/h4-7,15,17H,3,8-14H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | AKROKISXWKAFGQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|