C21H29IN4O — CID 111598079
2-(2-anilino-3-methylbutyl)-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide (PubChem CID 111598079) has the molecular formula C21H29IN4O and a molecular weight of 480.39 g/mol. Its IUPAC name is 2-(2-anilino-3-methylbutyl)-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide.
| Compound Name | 2-(2-anilino-3-methylbutyl)-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598079 |
| Molecular Formula | C21H29IN4O |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-(2-anilino-3-methylbutyl)-1-(3,4-dihydro-2H-chromen-4-yl)guanidine;hydroiodide |
| SMILES | CC(C)C(C/N=C(\N)NC1CCOc2ccccc21)Nc1ccccc1.I |
| InChI | InChI=1S/C21H28N4O.HI/c1-15(2)19(24-16-8-4-3-5-9-16)14-23-21(22)25-18-12-13-26-20-11-7-6-10-17(18)20;/h3-11,15,18-19,24H,12-14H2,1-2H3,(H3,22,23,25);1H |
| InChIKey | RUPCJRISNLBDCB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|