C22H30N4O — CID 111056321
2-benzyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,1-dimethylguanidine (PubChem CID 111056321) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-benzyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,1-dimethylguanidine.
| Compound Name | 2-benzyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111056321 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-benzyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCC(O)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H30N4O/c1-25(2)22(23-14-18-8-4-3-5-9-18)24-15-21(27)17-26-13-12-19-10-6-7-11-20(19)16-26/h3-11,21,27H,12-17H2,1-2H3,(H,23,24) |
| InChIKey | XJPKWWCYMYTPTN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|