C16H28IN5O — CID 111057155
2-[2-(4-ethylpiperazin-1-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111057155) has the molecular formula C16H28IN5O and a molecular weight of 433.34 g/mol. Its IUPAC name is 2-[2-(4-ethylpiperazin-1-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-ethylpiperazin-1-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111057155 |
| Molecular Formula | C16H28IN5O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[2-(4-ethylpiperazin-1-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | CCN1CCN(CC/N=C(\N)Nc2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C16H27N5O.HI/c1-3-20-10-12-21(13-11-20)9-8-18-16(17)19-14-4-6-15(22-2)7-5-14;/h4-7H,3,8-13H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | WBYVQEODZRZWBG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|