C17H23IN4OS — CID 111078768
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111078768) has the molecular formula C17H23IN4OS and a molecular weight of 458.37 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111078768 |
| Molecular Formula | C17H23IN4OS |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCN2CCc3sccc3C2)cc1.I |
| InChI | InChI=1S/C17H22N4OS.HI/c1-22-15-4-2-14(3-5-15)20-17(18)19-8-10-21-9-6-16-13(12-21)7-11-23-16;/h2-5,7,11H,6,8-10,12H2,1H3,(H3,18,19,20);1H |
| InChIKey | ORTAZDSIEABLOM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|