C14H23IN4S — CID 110030520
1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 110030520) has the molecular formula C14H23IN4S and a molecular weight of 406.34 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110030520 |
| Molecular Formula | C14H23IN4S |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCN1CCc2sccc2C1)C1CC1.I |
| InChI | InChI=1S/C14H22N4S.HI/c1-17(12-2-3-12)14(15)16-6-8-18-7-4-13-11(10-18)5-9-19-13;/h5,9,12H,2-4,6-8,10H2,1H3,(H2,15,16);1H |
| InChIKey | UPHSDQJGYCBCIV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|