C21H28N4S2 — CID 110030300
1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(4-methylsulfanylphenyl)ethyl]-1-methylguanidine (PubChem CID 110030300) has the molecular formula C21H28N4S2 and a molecular weight of 400.62 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(4-methylsulfanylphenyl)ethyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(4-methylsulfanylphenyl)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 110030300 |
| Molecular Formula | C21H28N4S2 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-cyclopropyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(4-methylsulfanylphenyl)ethyl]-1-methylguanidine |
| SMILES | CSc1ccc(C(C/N=C(\N)N(C)C2CC2)N2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C21H28N4S2/c1-24(17-5-6-17)21(22)23-13-19(15-3-7-18(26-2)8-4-15)25-11-9-20-16(14-25)10-12-27-20/h3-4,7-8,10,12,17,19H,5-6,9,11,13-14H2,1-2H3,(H2,22,23) |
| InChIKey | YPAXEWLNXNTPNT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|