C9H19F3IN3O — CID 111057669
2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111057669) has the molecular formula C9H19F3IN3O and a molecular weight of 369.17 g/mol. Its IUPAC name is 2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111057669 |
| Molecular Formula | C9H19F3IN3O |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-propyl-1-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCC/N=C(\N)NCCCOCC(F)(F)F.I |
| InChI | InChI=1S/C9H18F3N3O.HI/c1-2-4-14-8(13)15-5-3-6-16-7-9(10,11)12;/h2-7H2,1H3,(H3,13,14,15);1H |
| InChIKey | FRZNVFLDSVQXPX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|