C8H17F2N3O — CID 103090737
1-[2-(2,2-difluoroethoxy)ethyl]-2-propylguanidine (PubChem CID 103090737) has the molecular formula C8H17F2N3O and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)ethyl]-2-propylguanidine.
| Compound Name | 1-[2-(2,2-difluoroethoxy)ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 103090737 |
| Molecular Formula | C8H17F2N3O |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(\N)NCCOCC(F)F |
| InChI | InChI=1S/C8H17F2N3O/c1-2-3-12-8(11)13-4-5-14-6-7(9)10/h7H,2-6H2,1H3,(H3,11,12,13) |
| InChIKey | CZJIWMDFBRMFFY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|