C9H19F2N3O — CID 103090733
1-[2-(2,2-difluoroethoxy)ethyl]-2-(2-methylpropyl)guanidine (PubChem CID 103090733) has the molecular formula C9H19F2N3O and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)ethyl]-2-(2-methylpropyl)guanidine.
| Compound Name | 1-[2-(2,2-difluoroethoxy)ethyl]-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 103090733 |
| Molecular Formula | C9H19F2N3O |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)ethyl]-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(\N)NCCOCC(F)F |
| InChI | InChI=1S/C9H19F2N3O/c1-7(2)5-14-9(12)13-3-4-15-6-8(10)11/h7-8H,3-6H2,1-2H3,(H3,12,13,14) |
| InChIKey | NBPGWLWIAGRSHU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|