C7H15F2N3O — CID 103090734
2-[2-(2,2-difluoroethoxy)ethyl]-1-ethylguanidine (PubChem CID 103090734) has the molecular formula C7H15F2N3O and a molecular weight of 195.21 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-1-ethylguanidine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1-ethylguanidine |
|---|---|
| PubChem CID | 103090734 |
| Molecular Formula | C7H15F2N3O |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1-ethylguanidine |
| SMILES | CCN/C(N)=N/CCOCC(F)F |
| InChI | InChI=1S/C7H15F2N3O/c1-2-11-7(10)12-3-4-13-5-6(8)9/h6H,2-5H2,1H3,(H3,10,11,12) |
| InChIKey | VOKKDIIPVYZJQY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|