C18H22FN3O3 — CID 111058164
2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine (PubChem CID 111058164) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111058164 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine |
| SMILES | COc1ccc(C/N=C(\N)NCC(O)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C18H22FN3O3/c1-24-16-8-7-12(9-17(16)25-2)10-21-18(20)22-11-15(23)13-5-3-4-6-14(13)19/h3-9,15,23H,10-11H2,1-2H3,(H3,20,21,22) |
| InChIKey | PLOKGZUOZVHNEC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|