C19H25N3O4 — CID 111803148
2-[(3,4-dimethoxyphenyl)methyl]-1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine (PubChem CID 111803148) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111803148 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]guanidine |
| SMILES | COc1cccc(C(O)CN/C(N)=N/Cc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C19H25N3O4/c1-24-15-6-4-5-14(10-15)16(23)12-22-19(20)21-11-13-7-8-17(25-2)18(9-13)26-3/h4-10,16,23H,11-12H2,1-3H3,(H3,20,21,22) |
| InChIKey | OFVOBIVFUDPCKI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|