C19H34IN5 — CID 111059138
2-[3-(4-benzylpiperazin-1-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111059138) has the molecular formula C19H34IN5 and a molecular weight of 459.42 g/mol. Its IUPAC name is 2-[3-(4-benzylpiperazin-1-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[3-(4-benzylpiperazin-1-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111059138 |
| Molecular Formula | C19H34IN5 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-[3-(4-benzylpiperazin-1-yl)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCCCN1CCN(Cc2ccccc2)CC1)N(C)C.I |
| InChI | InChI=1S/C19H33N5.HI/c1-21(2)19(22(3)4)20-11-8-12-23-13-15-24(16-14-23)17-18-9-6-5-7-10-18;/h5-7,9-10H,8,11-17H2,1-4H3;1H |
| InChIKey | YHBMNMBUTVCRKF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 25.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|