C21H37IN4 — CID 111807955
2-[4-(4-benzylpiperidin-1-yl)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111807955) has the molecular formula C21H37IN4 and a molecular weight of 472.46 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperidin-1-yl)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[4-(4-benzylpiperidin-1-yl)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111807955 |
| Molecular Formula | C21H37IN4 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[4-(4-benzylpiperidin-1-yl)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCCCCN1CCC(Cc2ccccc2)CC1)N(C)C.I |
| InChI | InChI=1S/C21H36N4.HI/c1-23(2)21(24(3)4)22-14-8-9-15-25-16-12-20(13-17-25)18-19-10-6-5-7-11-19;/h5-7,10-11,20H,8-9,12-18H2,1-4H3;1H |
| InChIKey | NEEZAKQPJFJEPE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|