C19H22ClN3O4 — CID 111059347
2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-[(3,4-dimethoxyphenyl)methyl]guanidine (PubChem CID 111059347) has the molecular formula C19H22ClN3O4 and a molecular weight of 391.86 g/mol. Its IUPAC name is 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-[(3,4-dimethoxyphenyl)methyl]guanidine.
| Compound Name | 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-[(3,4-dimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111059347 |
| Molecular Formula | C19H22ClN3O4 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-[(3,4-dimethoxyphenyl)methyl]guanidine |
| SMILES | COc1ccc(CN/C(N)=N/Cc2cc(Cl)c3c(c2)OCCO3)cc1OC |
| InChI | InChI=1S/C19H22ClN3O4/c1-24-15-4-3-12(8-16(15)25-2)10-22-19(21)23-11-13-7-14(20)18-17(9-13)26-5-6-27-18/h3-4,7-9H,5-6,10-11H2,1-2H3,(H3,21,22,23) |
| InChIKey | ZIQZIJQOMURMBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|