About pyridin-1-ium perchlorate
pyridin-1-ium perchlorate (PubChem CID 11105938) has the molecular formula C5H6ClNO4
and a molecular weight of 179.56 g/mol. Its IUPAC name is pyridin-1-ium perchlorate.
Molecular Properties
| Compound Name | pyridin-1-ium perchlorate |
| PubChem CID | 11105938 |
| Molecular Formula | C5H6ClNO4 |
| Molecular Weight | 179.56 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | pyridin-1-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C5H5N.ClHO4/c1-2-4-6-5-3-1;2-1(3,4)5/h1-5H;(H,2,3,4,5) |
| InChIKey | JLKXXDAJGKKSNK-UHFFFAOYSA-N |
| XLogP | -4.26 |
| TPSA | 106.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.56 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-1-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium perchlorate?
The IUPAC name of pyridin-1-ium perchlorate (CID 11105938) is pyridin-1-ium perchlorate.
What is the SMILES notation for pyridin-1-ium perchlorate?
The canonical SMILES for pyridin-1-ium perchlorate is [O-][Cl+3]([O-])([O-])[O-].c1cc[nH+]cc1.
What is the InChIKey of pyridin-1-ium perchlorate?
The InChIKey is JLKXXDAJGKKSNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.ClHO4/c1-2-4-6-5-3-1;2-1(3,4)5/h1-5H;(H,2,3,4,5).
What are the key properties of pyridin-1-ium perchlorate?
pyridin-1-ium perchlorate has a molecular weight of 179.56 g/mol, XLogP of -4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium perchlorate is sourced from PubChem (CID 11105938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).