About pyridin-1-ium;sulfuric acid;chloride
pyridin-1-ium;sulfuric acid;chloride (PubChem CID 174872617) has the molecular formula C5H8ClNO4S
and a molecular weight of 213.64 g/mol. Its IUPAC name is pyridin-1-ium;sulfuric acid;chloride.
Molecular Properties
| Compound Name | pyridin-1-ium;sulfuric acid;chloride |
| PubChem CID | 174872617 |
| Molecular Formula | C5H8ClNO4S |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | pyridin-1-ium;sulfuric acid;chloride |
| SMILES | O=S(=O)(O)O.[Cl-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C5H5N.ClH.H2O4S/c1-2-4-6-5-3-1;;1-5(2,3)4/h1-5H;1H;(H2,1,2,3,4) |
| InChIKey | SVKFNWPEZNYDHW-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium;sulfuric acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium;sulfuric acid;chloride?
The IUPAC name of pyridin-1-ium;sulfuric acid;chloride (CID 174872617) is pyridin-1-ium;sulfuric acid;chloride.
What is the SMILES notation for pyridin-1-ium;sulfuric acid;chloride?
The canonical SMILES for pyridin-1-ium;sulfuric acid;chloride is O=S(=O)(O)O.[Cl-].c1cc[nH+]cc1.
What is the InChIKey of pyridin-1-ium;sulfuric acid;chloride?
The InChIKey is SVKFNWPEZNYDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.ClH.H2O4S/c1-2-4-6-5-3-1;;1-5(2,3)4/h1-5H;1H;(H2,1,2,3,4).
What are the key properties of pyridin-1-ium;sulfuric acid;chloride?
pyridin-1-ium;sulfuric acid;chloride has a molecular weight of 213.64 g/mol, XLogP of -3.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium;sulfuric acid;chloride is sourced from PubChem (CID 174872617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).