C22H30N4O3 — CID 111061643
N-[3-[[[amino-(2,5-diethoxyanilino)methylidene]amino]methyl]phenyl]butanamide (PubChem CID 111061643) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[3-[[[amino-(2,5-diethoxyanilino)methylidene]amino]methyl]phenyl]butanamide.
| Compound Name | N-[3-[[[amino-(2,5-diethoxyanilino)methylidene]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111061643 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[3-[[[amino-(2,5-diethoxyanilino)methylidene]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(C/N=C(\N)Nc2cc(OCC)ccc2OCC)c1 |
| InChI | InChI=1S/C22H30N4O3/c1-4-8-21(27)25-17-10-7-9-16(13-17)15-24-22(23)26-19-14-18(28-5-2)11-12-20(19)29-6-3/h7,9-14H,4-6,8,15H2,1-3H3,(H,25,27)(H3,23,24,26) |
| InChIKey | SECWPKZUOMFAMW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|