C16H30N4O — CID 111063749
N'-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]morpholine-4-carboximidamide (PubChem CID 111063749) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is N'-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]morpholine-4-carboximidamide.
| Compound Name | N'-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111063749 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | N'-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]morpholine-4-carboximidamide |
| SMILES | C=CCN(CC=C)C(C/N=C(\N)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C16H30N4O/c1-5-7-19(8-6-2)15(14(3)4)13-18-16(17)20-9-11-21-12-10-20/h5-6,14-15H,1-2,7-13H2,3-4H3,(H2,17,18) |
| InChIKey | KMVFOITZCAPLIF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|