C17H27N5O2 — CID 111066315
methyl N-[4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]carbamate (PubChem CID 111066315) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is methyl N-[4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 111066315 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | methyl N-[4-[[[amino-[(1-ethylpyrrolidin-2-yl)methylamino]methylidene]amino]methyl]phenyl]carbamate |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1ccc(NC(=O)OC)cc1 |
| InChI | InChI=1S/C17H27N5O2/c1-3-22-10-4-5-15(22)12-20-16(18)19-11-13-6-8-14(9-7-13)21-17(23)24-2/h6-9,15H,3-5,10-12H2,1-2H3,(H,21,23)(H3,18,19,20) |
| InChIKey | JWTKZNLAVIPOMR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|