C15H24IN3O3 — CID 111066682
2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111066682) has the molecular formula C15H24IN3O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is 2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066682 |
| Molecular Formula | C15H24IN3O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(N)=N/Cc1ccc(OCCO)c(OC)c1.I |
| InChI | InChI=1S/C15H23N3O3.HI/c1-11(2)9-17-15(16)18-10-12-4-5-13(21-7-6-19)14(8-12)20-3;/h4-5,8,19H,1,6-7,9-10H2,2-3H3,(H3,16,17,18);1H |
| InChIKey | LVEPCGPIJQSFOH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|