C24H28IN3O3 — CID 111084988
2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-phenylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111084988) has the molecular formula C24H28IN3O3 and a molecular weight of 533.41 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-phenylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-phenylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111084988 |
| Molecular Formula | C24H28IN3O3 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(2-phenylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCCOc2ccccc2-c2ccccc2)cc1OC.I |
| InChI | InChI=1S/C24H27N3O3.HI/c1-28-22-13-12-18(16-23(22)29-2)17-27-24(25)26-14-15-30-21-11-7-6-10-20(21)19-8-4-3-5-9-19;/h3-13,16H,14-15,17H2,1-2H3,(H3,25,26,27);1H |
| InChIKey | AOUFIHHQIIHWRW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|