C18H31N3O2 — CID 111067464
2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-octylguanidine (PubChem CID 111067464) has the molecular formula C18H31N3O2 and a molecular weight of 321.46 g/mol. Its IUPAC name is 2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-octylguanidine.
| Compound Name | 2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-octylguanidine |
|---|---|
| PubChem CID | 111067464 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-1-octylguanidine |
| SMILES | CCCCCCCCN/C(N)=N/CC(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H31N3O2/c1-3-4-5-6-7-8-13-20-18(19)21-14-17(22)15-9-11-16(23-2)12-10-15/h9-12,17,22H,3-8,13-14H2,1-2H3,(H3,19,20,21) |
| InChIKey | SMMVBYCZNRGNNQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|