C19H22F3N3O3 — CID 110926143
2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine (PubChem CID 110926143) has the molecular formula C19H22F3N3O3 and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 110926143 |
| Molecular Formula | C19H22F3N3O3 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine |
| SMILES | COc1ccc(CCN/C(N)=N/CC(O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H22F3N3O3/c1-27-15-6-2-13(3-7-15)10-11-24-18(23)25-12-17(26)14-4-8-16(9-5-14)28-19(20,21)22/h2-9,17,26H,10-12H2,1H3,(H3,23,24,25) |
| InChIKey | CQBHGHFZZDBMJA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|