C18H28FN5O2 — CID 111072413
2-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1-(1-methoxypropan-2-yl)guanidine (PubChem CID 111072413) has the molecular formula C18H28FN5O2 and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 111072413 |
| Molecular Formula | C18H28FN5O2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-1-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)N/C(N)=N/CCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H28FN5O2/c1-14(13-26-2)22-18(20)21-8-7-17(25)24-11-9-23(10-12-24)16-5-3-15(19)4-6-16/h3-6,14H,7-13H2,1-2H3,(H3,20,21,22) |
| InChIKey | LVJOBSJQYZMRCY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|