C16H27IN4O3S — CID 111072498
1-(1-methoxypropan-2-yl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111072498) has the molecular formula C16H27IN4O3S and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1-methoxypropan-2-yl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111072498 |
| Molecular Formula | C16H27IN4O3S |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/Cc1ccc(S(=O)(=O)N2CCCC2)cc1.I |
| InChI | InChI=1S/C16H26N4O3S.HI/c1-13(12-23-2)19-16(17)18-11-14-5-7-15(8-6-14)24(21,22)20-9-3-4-10-20;/h5-8,13H,3-4,9-12H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | OWTCNBIPGROIOQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|