C11H16F2O3 — CID 11107253
ethyl 4,4-difluoro-2-(1-hydroxycyclopentyl)but-3-enoate (PubChem CID 11107253) has the molecular formula C11H16F2O3 and a molecular weight of 234.24 g/mol. Its IUPAC name is ethyl 4,4-difluoro-2-(1-hydroxycyclopentyl)but-3-enoate.
| Compound Name | ethyl 4,4-difluoro-2-(1-hydroxycyclopentyl)but-3-enoate |
|---|---|
| PubChem CID | 11107253 |
| Molecular Formula | C11H16F2O3 |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl 4,4-difluoro-2-(1-hydroxycyclopentyl)but-3-enoate |
| SMILES | CCOC(=O)C(C=C(F)F)C1(O)CCCC1 |
| InChI | InChI=1S/C11H16F2O3/c1-2-16-10(14)8(7-9(12)13)11(15)5-3-4-6-11/h7-8,15H,2-6H2,1H3 |
| InChIKey | KGXJDMIMCZBFED-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |