C21H28IN3O — CID 111075070
1-(3,5-dimethylphenyl)-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111075070) has the molecular formula C21H28IN3O and a molecular weight of 465.38 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111075070 |
| Molecular Formula | C21H28IN3O |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[(2-phenyloxan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC2CCCOC2c2ccccc2)c1.I |
| InChI | InChI=1S/C21H27N3O.HI/c1-15-11-16(2)13-19(12-15)24-21(22)23-14-18-9-6-10-25-20(18)17-7-4-3-5-8-17;/h3-5,7-8,11-13,18,20H,6,9-10,14H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | POZJKZOIRFUYDE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|