C11H18N2O4 — CID 11107525
ethyl 3,6-diethoxy-2,5-dihydropyrazine-2-carboxylate (PubChem CID 11107525) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 3,6-diethoxy-2,5-dihydropyrazine-2-carboxylate.
| Compound Name | ethyl 3,6-diethoxy-2,5-dihydropyrazine-2-carboxylate |
|---|---|
| PubChem CID | 11107525 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl 3,6-diethoxy-2,5-dihydropyrazine-2-carboxylate |
| SMILES | CCOC(=O)C1N=C(OCC)CN=C1OCC |
| InChI | InChI=1S/C11H18N2O4/c1-4-15-8-7-12-10(16-5-2)9(13-8)11(14)17-6-3/h9H,4-7H2,1-3H3 |
| InChIKey | WXCQDAAMGBRNOQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |