C18H24N4 — CID 111078721
2-[2-[benzyl(methyl)amino]ethyl]-1-(4-methylphenyl)guanidine (PubChem CID 111078721) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-[2-[benzyl(methyl)amino]ethyl]-1-(4-methylphenyl)guanidine.
| Compound Name | 2-[2-[benzyl(methyl)amino]ethyl]-1-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 111078721 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[2-[benzyl(methyl)amino]ethyl]-1-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCN(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H24N4/c1-15-8-10-17(11-9-15)21-18(19)20-12-13-22(2)14-16-6-4-3-5-7-16/h3-11H,12-14H2,1-2H3,(H3,19,20,21) |
| InChIKey | LZQRWDMUSNTIDC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|