C14H19IN4O2 — CID 111078858
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111078858) has the molecular formula C14H19IN4O2 and a molecular weight of 402.24 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111078858 |
| Molecular Formula | C14H19IN4O2 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/Cc2nc(C)c(C)o2)c1.I |
| InChI | InChI=1S/C14H18N4O2.HI/c1-9-10(2)20-13(17-9)8-16-14(15)18-11-5-4-6-12(7-11)19-3;/h4-7H,8H2,1-3H3,(H3,15,16,18);1H |
| InChIKey | KSCSFCAVZXLBAG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|