C18H19IN4O2 — CID 111809385
1-(3-methoxyphenyl)-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111809385) has the molecular formula C18H19IN4O2 and a molecular weight of 450.28 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxyphenyl)-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111809385 |
| Molecular Formula | C18H19IN4O2 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/Cc2coc(-c3ccccc3)n2)c1.I |
| InChI | InChI=1S/C18H18N4O2.HI/c1-23-16-9-5-8-14(10-16)22-18(19)20-11-15-12-24-17(21-15)13-6-3-2-4-7-13;/h2-10,12H,11H2,1H3,(H3,19,20,22);1H |
| InChIKey | FUQHFPBBIQBOHY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|