C15H17NO3 — CID 11108046
methyl 3-(2,5-dimethylpyrrol-1-yl)-5-methoxybenzoate (PubChem CID 11108046) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 3-(2,5-dimethylpyrrol-1-yl)-5-methoxybenzoate.
| Compound Name | methyl 3-(2,5-dimethylpyrrol-1-yl)-5-methoxybenzoate |
|---|---|
| PubChem CID | 11108046 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl 3-(2,5-dimethylpyrrol-1-yl)-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(-n2c(C)ccc2C)c1 |
| InChI | InChI=1S/C15H17NO3/c1-10-5-6-11(2)16(10)13-7-12(15(17)19-4)8-14(9-13)18-3/h5-9H,1-4H3 |
| InChIKey | ZTJGVRPNRMKTQT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|