C16H19NO4 — CID 2808808
methyl 2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzoate (PubChem CID 2808808) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2808808 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-(2,5-dimethylpyrrol-1-yl)-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C16H19NO4/c1-10-6-7-11(2)17(10)13-9-15(20-4)14(19-3)8-12(13)16(18)21-5/h6-9H,1-5H3 |
| InChIKey | JMGDVUYVXVYJKO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|