About methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate
methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate (PubChem CID 146283934) has the molecular formula C15H16FNO2
and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate.
Molecular Properties
| Compound Name | methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate |
| PubChem CID | 146283934 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate |
| SMILES | COC(=O)c1cc(F)cc(C)c1-n1c(C)ccc1C |
| InChI | InChI=1S/C15H16FNO2/c1-9-7-12(16)8-13(15(18)19-4)14(9)17-10(2)5-6-11(17)3/h5-8H,1-4H3 |
| InChIKey | OMQCCZGAXLOCLO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate?
The IUPAC name of methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate (CID 146283934) is methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate.
What is the SMILES notation for methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate?
The canonical SMILES for methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate is COC(=O)c1cc(F)cc(C)c1-n1c(C)ccc1C.
What is the InChIKey of methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate?
The InChIKey is OMQCCZGAXLOCLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FNO2/c1-9-7-12(16)8-13(15(18)19-4)14(9)17-10(2)5-6-11(17)3/h5-8H,1-4H3.
What are the key properties of methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate?
methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate has a molecular weight of 261.30 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,5-dimethylpyrrol-1-yl)-5-fluoro-3-methylbenzoate is sourced from PubChem (CID 146283934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).