C24H32N4O2 — CID 111083753
2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-(3-propan-2-ylphenyl)guanidine (PubChem CID 111083753) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-(3-propan-2-ylphenyl)guanidine.
| Compound Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-(3-propan-2-ylphenyl)guanidine |
|---|---|
| PubChem CID | 111083753 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-1-(3-propan-2-ylphenyl)guanidine |
| SMILES | CC1CN(C(=O)c2ccc(C/N=C(\N)Nc3cccc(C(C)C)c3)cc2)CC(C)O1 |
| InChI | InChI=1S/C24H32N4O2/c1-16(2)21-6-5-7-22(12-21)27-24(25)26-13-19-8-10-20(11-9-19)23(29)28-14-17(3)30-18(4)15-28/h5-12,16-18H,13-15H2,1-4H3,(H3,25,26,27) |
| InChIKey | BRAKLWDEPMIIMQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|