C24H36IN5O — CID 111084852
2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111084852) has the molecular formula C24H36IN5O and a molecular weight of 537.49 g/mol. Its IUPAC name is 2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111084852 |
| Molecular Formula | C24H36IN5O |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2-[[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(N)=N/Cc2ccc(CN3CCCN(C)CC3)cc2)cc1.I |
| InChI | InChI=1S/C24H35N5O.HI/c1-19(2)30-23-11-9-22(10-12-23)27-24(25)26-17-20-5-7-21(8-6-20)18-29-14-4-13-28(3)15-16-29;/h5-12,19H,4,13-18H2,1-3H3,(H3,25,26,27);1H |
| InChIKey | RALNSDAHOHTCPM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|