C14H11ClO2S — CID 11108680
3-(chloromethyl)-2,7-dimethylthiochromeno[3,2-b]furan-9-one (PubChem CID 11108680) has the molecular formula C14H11ClO2S and a molecular weight of 278.76 g/mol. Its IUPAC name is 3-(chloromethyl)-2,7-dimethylthiochromeno[3,2-b]furan-9-one.
| Compound Name | 3-(chloromethyl)-2,7-dimethylthiochromeno[3,2-b]furan-9-one |
|---|---|
| PubChem CID | 11108680 |
| Molecular Formula | C14H11ClO2S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 3-(chloromethyl)-2,7-dimethylthiochromeno[3,2-b]furan-9-one |
| SMILES | Cc1ccc2sc3c(CCl)c(C)oc3c(=O)c2c1 |
| InChI | InChI=1S/C14H11ClO2S/c1-7-3-4-11-9(5-7)12(16)13-14(18-11)10(6-15)8(2)17-13/h3-5H,6H2,1-2H3 |
| InChIKey | UODJRGVUJADHEF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|