C12H26IN3O2 — CID 111088638
1-(3-ethoxypropyl)-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 111088638) has the molecular formula C12H26IN3O2 and a molecular weight of 371.26 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111088638 |
| Molecular Formula | C12H26IN3O2 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(N)=N/CC1(O)CCCC1.I |
| InChI | InChI=1S/C12H25N3O2.HI/c1-2-17-9-5-8-14-11(13)15-10-12(16)6-3-4-7-12;/h16H,2-10H2,1H3,(H3,13,14,15);1H |
| InChIKey | WFZHTWVHNOIEQT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|