C18H24N4S — CID 111088791
1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111088791) has the molecular formula C18H24N4S and a molecular weight of 328.49 g/mol. Its IUPAC name is 1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111088791 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CC1Cc2ccccc2N1CCN/C(N)=N/CCc1cccs1 |
| InChI | InChI=1S/C18H24N4S/c1-14-13-15-5-2-3-7-17(15)22(14)11-10-21-18(19)20-9-8-16-6-4-12-23-16/h2-7,12,14H,8-11,13H2,1H3,(H3,19,20,21) |
| InChIKey | RICALEHYWPNCHI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|