C17H35NO2 — CID 11108896
(2R)-1-[(2S,6R)-6-[(2R)-2-hydroxyhexyl]piperidin-2-yl]hexan-2-ol (PubChem CID 11108896) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is (2R)-1-[(2S,6R)-6-[(2R)-2-hydroxyhexyl]piperidin-2-yl]hexan-2-ol.
| Compound Name | (2R)-1-[(2S,6R)-6-[(2R)-2-hydroxyhexyl]piperidin-2-yl]hexan-2-ol |
|---|---|
| PubChem CID | 11108896 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | (2R)-1-[(2S,6R)-6-[(2R)-2-hydroxyhexyl]piperidin-2-yl]hexan-2-ol |
| SMILES | CCCC[C@@H](O)C[C@H]1CCC[C@@H](C[C@H](O)CCCC)N1 |
| InChI | InChI=1S/C17H35NO2/c1-3-5-10-16(19)12-14-8-7-9-15(18-14)13-17(20)11-6-4-2/h14-20H,3-13H2,1-2H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | BSSGOTKRPSZPGT-YYIAUSFCSA-N |
| XLogP | 3.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |