About (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol
(2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol (PubChem CID 162974675) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol |
| PubChem CID | 162974675 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol |
| SMILES | CC[C@H](O)C[C@H]1CCC[C@@H](C[C@H](O)c2ccccc2)N1 |
| InChI | InChI=1S/C17H27NO2/c1-2-16(19)11-14-9-6-10-15(18-14)12-17(20)13-7-4-3-5-8-13/h3-5,7-8,14-20H,2,6,9-12H2,1H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | WALGFYSBKDXXNZ-QZWWFDLISA-N |
| XLogP | 2.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol?
The IUPAC name of (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol (CID 162974675) is (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol.
What is the SMILES notation for (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol?
The canonical SMILES for (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol is CC[C@H](O)C[C@H]1CCC[C@@H](C[C@H](O)c2ccccc2)N1.
What is the InChIKey of (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol?
The InChIKey is WALGFYSBKDXXNZ-QZWWFDLISA-N. The full InChI is InChI=1S/C17H27NO2/c1-2-16(19)11-14-9-6-10-15(18-14)12-17(20)13-7-4-3-5-8-13/h3-5,7-8,14-20H,2,6,9-12H2,1H3/t14-,15+,16+,17+/m1/s1.
What are the key properties of (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol?
(2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol has a molecular weight of 277.41 g/mol, XLogP of 2.78, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(2R,6S)-6-[(2S)-2-hydroxy-2-phenylethyl]piperidin-2-yl]butan-2-ol is sourced from PubChem (CID 162974675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).