C15H24BrN3 — CID 111096283
2-[2-(3-bromophenyl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111096283) has the molecular formula C15H24BrN3 and a molecular weight of 326.28 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2-(3-bromophenyl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111096283 |
| Molecular Formula | C15H24BrN3 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[2-(3-bromophenyl)-2-methylpropyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCC(C)(C)c1cccc(Br)c1)N(C)C |
| InChI | InChI=1S/C15H24BrN3/c1-15(2,12-8-7-9-13(16)10-12)11-17-14(18(3)4)19(5)6/h7-10H,11H2,1-6H3 |
| InChIKey | CMBFOJNQPAMLMX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|