C19H32N4O3 — CID 111096921
tert-butyl N-[2-[[amino-(4-propan-2-yloxyanilino)methylidene]amino]ethyl]-N-ethylcarbamate (PubChem CID 111096921) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[amino-(4-propan-2-yloxyanilino)methylidene]amino]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[[amino-(4-propan-2-yloxyanilino)methylidene]amino]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 111096921 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | tert-butyl N-[2-[[amino-(4-propan-2-yloxyanilino)methylidene]amino]ethyl]-N-ethylcarbamate |
| SMILES | CCN(CC/N=C(\N)Nc1ccc(OC(C)C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N4O3/c1-7-23(18(24)26-19(4,5)6)13-12-21-17(20)22-15-8-10-16(11-9-15)25-14(2)3/h8-11,14H,7,12-13H2,1-6H3,(H3,20,21,22) |
| InChIKey | IEYCPXAGUXVSBY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|