C20H33IN4O3 — CID 111099549
N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111099549) has the molecular formula C20H33IN4O3 and a molecular weight of 504.41 g/mol. Its IUPAC name is N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111099549 |
| Molecular Formula | C20H33IN4O3 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CN(CCOc1cccc(C/N=C(\N)N2CCOCC2)c1)C1CCOCC1.I |
| InChI | InChI=1S/C20H32N4O3.HI/c1-23(18-5-10-25-11-6-18)7-14-27-19-4-2-3-17(15-19)16-22-20(21)24-8-12-26-13-9-24;/h2-4,15,18H,5-14,16H2,1H3,(H2,21,22);1H |
| InChIKey | FYNRJXQZTGOASF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|