C26H37IN4O2 — CID 110984863
N-ethyl-N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110984863) has the molecular formula C26H37IN4O2 and a molecular weight of 564.51 g/mol. Its IUPAC name is N-ethyl-N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110984863 |
| Molecular Formula | C26H37IN4O2 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | N-ethyl-N'-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCCN(C)C2CCOCC2)c1)N1CCc2ccccc21.I |
| InChI | InChI=1S/C26H36N4O2.HI/c1-3-27-26(30-14-11-22-8-4-5-10-25(22)30)28-20-21-7-6-9-24(19-21)32-18-15-29(2)23-12-16-31-17-13-23;/h4-10,19,23H,3,11-18,20H2,1-2H3,(H,27,28);1H |
| InChIKey | XHOHYDZXILDZNV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|