C25H44N4O2 — CID 111203272
1-ethyl-3-(5-methylhexan-2-yl)-2-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]guanidine (PubChem CID 111203272) has the molecular formula C25H44N4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 1-ethyl-3-(5-methylhexan-2-yl)-2-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(5-methylhexan-2-yl)-2-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111203272 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 1-ethyl-3-(5-methylhexan-2-yl)-2-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCCN(C)C2CCOCC2)c1)NC(C)CCC(C)C |
| InChI | InChI=1S/C25H44N4O2/c1-6-26-25(28-21(4)11-10-20(2)3)27-19-22-8-7-9-24(18-22)31-17-14-29(5)23-12-15-30-16-13-23/h7-9,18,20-21,23H,6,10-17,19H2,1-5H3,(H2,26,27,28) |
| InChIKey | IESRVCOBEFPMRL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|