C23H30N4O — CID 110983388
N-ethyl-N'-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 110983388) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N-ethyl-N'-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110983388 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-ethyl-N'-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCOCC2)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C23H30N4O/c1-2-24-23(27-11-10-21-8-3-4-9-22(21)27)25-17-19-6-5-7-20(16-19)18-26-12-14-28-15-13-26/h3-9,16H,2,10-15,17-18H2,1H3,(H,24,25) |
| InChIKey | UAVYXUDLEMAUGF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|